C24H31NO3 — CID 155238613
1-methoxy-3-[3-methyl-4-(1-pentylindol-2-yl)phenoxy]propan-2-ol (PubChem CID 155238613) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is 1-methoxy-3-[3-methyl-4-(1-pentylindol-2-yl)phenoxy]propan-2-ol.
| Compound Name | 1-methoxy-3-[3-methyl-4-(1-pentylindol-2-yl)phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 155238613 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | 1-methoxy-3-[3-methyl-4-(1-pentylindol-2-yl)phenoxy]propan-2-ol |
| SMILES | CCCCCn1c(-c2ccc(OCC(O)COC)cc2C)cc2ccccc21 |
| InChI | InChI=1S/C24H31NO3/c1-4-5-8-13-25-23-10-7-6-9-19(23)15-24(25)22-12-11-21(14-18(22)2)28-17-20(26)16-27-3/h6-7,9-12,14-15,20,26H,4-5,8,13,16-17H2,1-3H3 |
| InChIKey | RCHYKSSAMKCSMP-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 43.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|