C14H16BrClFN3O2 — CID 155244466
N-(3-bromo-6-carbamoyl-4-chloro-2-fluorophenyl)-1-methylpiperidine-4-carboxamide (PubChem CID 155244466) has the molecular formula C14H16BrClFN3O2 and a molecular weight of 392.66 g/mol. Its IUPAC name is N-(3-bromo-6-carbamoyl-4-chloro-2-fluorophenyl)-1-methylpiperidine-4-carboxamide.
| Compound Name | N-(3-bromo-6-carbamoyl-4-chloro-2-fluorophenyl)-1-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 155244466 |
| Molecular Formula | C14H16BrClFN3O2 |
| Molecular Weight | 392.66 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | N-(3-bromo-6-carbamoyl-4-chloro-2-fluorophenyl)-1-methylpiperidine-4-carboxamide |
| SMILES | CN1CCC(C(=O)Nc2c(C(N)=O)cc(Cl)c(Br)c2F)CC1 |
| InChI | InChI=1S/C14H16BrClFN3O2/c1-20-4-2-7(3-5-20)14(22)19-12-8(13(18)21)6-9(16)10(15)11(12)17/h6-7H,2-5H2,1H3,(H2,18,21)(H,19,22) |
| InChIKey | LZOQXRZAYHHQTN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.66 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|