C18H25BrFN3O4 — CID 178029268
N-(5-bromo-2-carbamoyl-4-fluorophenyl)-1-methylpyrrolidine-3-carboxamide;tert-butyl formate (PubChem CID 178029268) has the molecular formula C18H25BrFN3O4 and a molecular weight of 446.32 g/mol. Its IUPAC name is N-(5-bromo-2-carbamoyl-4-fluorophenyl)-1-methylpyrrolidine-3-carboxamide;tert-butyl formate.
| Compound Name | N-(5-bromo-2-carbamoyl-4-fluorophenyl)-1-methylpyrrolidine-3-carboxamide;tert-butyl formate |
|---|---|
| PubChem CID | 178029268 |
| Molecular Formula | C18H25BrFN3O4 |
| Molecular Weight | 446.32 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | N-(5-bromo-2-carbamoyl-4-fluorophenyl)-1-methylpyrrolidine-3-carboxamide;tert-butyl formate |
| SMILES | CC(C)(C)OC=O.CN1CCC(C(=O)Nc2cc(Br)c(F)cc2C(N)=O)C1 |
| InChI | InChI=1S/C13H15BrFN3O2.C5H10O2/c1-18-3-2-7(6-18)13(20)17-11-5-9(14)10(15)4-8(11)12(16)19;1-5(2,3)7-4-6/h4-5,7H,2-3,6H2,1H3,(H2,16,19)(H,17,20);4H,1-3H3 |
| InChIKey | FEQYOSHBMMOKAY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|