C11H8N2OS — CID 155264596
6-methyl-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one (PubChem CID 155264596) has the molecular formula C11H8N2OS and a molecular weight of 216.26 g/mol. Its IUPAC name is 6-methyl-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one.
| Compound Name | 6-methyl-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 155264596 |
| Molecular Formula | C11H8N2OS |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 6-methyl-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one |
| SMILES | Cc1cccc2c1sc1c(=O)[nH]cnc12 |
| InChI | InChI=1S/C11H8N2OS/c1-6-3-2-4-7-8-10(15-9(6)7)11(14)13-5-12-8/h2-5H,1H3,(H,12,13,14) |
| InChIKey | NVUPJLURQMXISZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |