C19H14N4O2S — CID 167965755
2-methyl-N-(4-oxo-3H-quinazolin-8-yl)-5-phenyl-1,3-thiazole-4-carboxamide (PubChem CID 167965755) has the molecular formula C19H14N4O2S and a molecular weight of 362.41 g/mol. Its IUPAC name is 2-methyl-N-(4-oxo-3H-quinazolin-8-yl)-5-phenyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-methyl-N-(4-oxo-3H-quinazolin-8-yl)-5-phenyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 167965755 |
| Molecular Formula | C19H14N4O2S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 2-methyl-N-(4-oxo-3H-quinazolin-8-yl)-5-phenyl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)Nc2cccc3c(=O)[nH]cnc23)c(-c2ccccc2)s1 |
| InChI | InChI=1S/C19H14N4O2S/c1-11-22-16(17(26-11)12-6-3-2-4-7-12)19(25)23-14-9-5-8-13-15(14)20-10-21-18(13)24/h2-10H,1H3,(H,23,25)(H,20,21,24) |
| InChIKey | QXNIPFAQOFZQEZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |