C20H21NO2 — CID 155266576
1-[4-[[4-[(1R,2S)-2-aminocyclopropyl]phenyl]methoxy]phenyl]cyclopropane-1-carbaldehyde (PubChem CID 155266576) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is 1-[4-[[4-[(1R,2S)-2-aminocyclopropyl]phenyl]methoxy]phenyl]cyclopropane-1-carbaldehyde.
| Compound Name | 1-[4-[[4-[(1R,2S)-2-aminocyclopropyl]phenyl]methoxy]phenyl]cyclopropane-1-carbaldehyde |
|---|---|
| PubChem CID | 155266576 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 1-[4-[[4-[(1R,2S)-2-aminocyclopropyl]phenyl]methoxy]phenyl]cyclopropane-1-carbaldehyde |
| SMILES | N[C@H]1C[C@@H]1c1ccc(COc2ccc(C3(C=O)CC3)cc2)cc1 |
| InChI | InChI=1S/C20H21NO2/c21-19-11-18(19)15-3-1-14(2-4-15)12-23-17-7-5-16(6-8-17)20(13-22)9-10-20/h1-8,13,18-19H,9-12,21H2/t18-,19+/m1/s1 |
| InChIKey | WDXDCNJCLHHBBO-MOPGFXCFSA-N |
| XLogP | 3.31 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|