About 3,3-diethyl-2,7-diazaspiro[3.5]nonane;formamide
3,3-diethyl-2,7-diazaspiro[3.5]nonane;formamide (PubChem CID 155267148) has the molecular formula C12H25N3O
and a molecular weight of 227.35 g/mol. Its IUPAC name is 3,3-diethyl-2,7-diazaspiro[3.5]nonane;formamide.
Molecular Properties
| Compound Name | 3,3-diethyl-2,7-diazaspiro[3.5]nonane;formamide |
| PubChem CID | 155267148 |
| Molecular Formula | C12H25N3O |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | 3,3-diethyl-2,7-diazaspiro[3.5]nonane;formamide |
| SMILES | CCC1(CC)NCC12CCNCC2.NC=O |
| InChI | InChI=1S/C11H22N2.CH3NO/c1-3-11(4-2)10(9-13-11)5-7-12-8-6-10;2-1-3/h12-13H,3-9H2,1-2H3;1H,(H2,2,3) |
| InChIKey | AJWTZRJDZWCKKR-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3,3-diethyl-2,7-diazaspiro[3.5]nonane;formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diethyl-2,7-diazaspiro[3.5]nonane;formamide?
The IUPAC name of 3,3-diethyl-2,7-diazaspiro[3.5]nonane;formamide (CID 155267148) is 3,3-diethyl-2,7-diazaspiro[3.5]nonane;formamide.
What is the SMILES notation for 3,3-diethyl-2,7-diazaspiro[3.5]nonane;formamide?
The canonical SMILES for 3,3-diethyl-2,7-diazaspiro[3.5]nonane;formamide is CCC1(CC)NCC12CCNCC2.NC=O.
What is the InChIKey of 3,3-diethyl-2,7-diazaspiro[3.5]nonane;formamide?
The InChIKey is AJWTZRJDZWCKKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2.CH3NO/c1-3-11(4-2)10(9-13-11)5-7-12-8-6-10;2-1-3/h12-13H,3-9H2,1-2H3;1H,(H2,2,3).
What are the key properties of 3,3-diethyl-2,7-diazaspiro[3.5]nonane;formamide?
3,3-diethyl-2,7-diazaspiro[3.5]nonane;formamide has a molecular weight of 227.35 g/mol, XLogP of 0.62, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diethyl-2,7-diazaspiro[3.5]nonane;formamide is sourced from PubChem (CID 155267148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).