C12H25N3O — CID 155267148
3,3-diethyl-2,7-diazaspiro[3.5]nonane;formamide (PubChem CID 155267148) has the molecular formula C12H25N3O and a molecular weight of 227.35 g/mol. Its IUPAC name is 3,3-diethyl-2,7-diazaspiro[3.5]nonane;formamide.
| Compound Name | 3,3-diethyl-2,7-diazaspiro[3.5]nonane;formamide |
|---|---|
| PubChem CID | 155267148 |
| Molecular Formula | C12H25N3O |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | 3,3-diethyl-2,7-diazaspiro[3.5]nonane;formamide |
| SMILES | CCC1(CC)NCC12CCNCC2.NC=O |
| InChI | InChI=1S/C11H22N2.CH3NO/c1-3-11(4-2)10(9-13-11)5-7-12-8-6-10;2-1-3/h12-13H,3-9H2,1-2H3;1H,(H2,2,3) |
| InChIKey | AJWTZRJDZWCKKR-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|