C26H26F3N3O5S2 — CID 155268442
[3,5-dimethyl-4-[[5-(4-methylphenyl)sulfonyl-7-propan-2-ylpyrrolo[2,3-b]pyrazin-2-yl]methyl]phenyl] trifluoromethanesulfonate (PubChem CID 155268442) has the molecular formula C26H26F3N3O5S2 and a molecular weight of 581.64 g/mol. Its IUPAC name is [3,5-dimethyl-4-[[5-(4-methylphenyl)sulfonyl-7-propan-2-ylpyrrolo[2,3-b]pyrazin-2-yl]methyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3,5-dimethyl-4-[[5-(4-methylphenyl)sulfonyl-7-propan-2-ylpyrrolo[2,3-b]pyrazin-2-yl]methyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 155268442 |
| Molecular Formula | C26H26F3N3O5S2 |
| Molecular Weight | 581.64 g/mol |
| Exact Mass | 581.13 |
| IUPAC Name | [3,5-dimethyl-4-[[5-(4-methylphenyl)sulfonyl-7-propan-2-ylpyrrolo[2,3-b]pyrazin-2-yl]methyl]phenyl] trifluoromethanesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(C(C)C)c3nc(Cc4c(C)cc(OS(=O)(=O)C(F)(F)F)cc4C)cnc32)cc1 |
| InChI | InChI=1S/C26H26F3N3O5S2/c1-15(2)23-14-32(38(33,34)21-8-6-16(3)7-9-21)25-24(23)31-19(13-30-25)12-22-17(4)10-20(11-18(22)5)37-39(35,36)26(27,28)29/h6-11,13-15H,12H2,1-5H3 |
| InChIKey | VSUKGOJKSQNGHK-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 108.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.64 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|