About 1-bromo-2-(2-bromophenoxy)benzene;dicyclohexylphosphane
1-bromo-2-(2-bromophenoxy)benzene;dicyclohexylphosphane (PubChem CID 155269265) has the molecular formula C24H31Br2OP
and a molecular weight of 526.29 g/mol. Its IUPAC name is 1-bromo-2-(2-bromophenoxy)benzene;dicyclohexylphosphane.
Molecular Properties
| Compound Name | 1-bromo-2-(2-bromophenoxy)benzene;dicyclohexylphosphane |
| PubChem CID | 155269265 |
| Molecular Formula | C24H31Br2OP |
| Molecular Weight | 526.29 g/mol |
| Exact Mass | 524.05 |
| IUPAC Name | 1-bromo-2-(2-bromophenoxy)benzene;dicyclohexylphosphane |
| SMILES | Brc1ccccc1Oc1ccccc1Br.C1CCC(PC2CCCCC2)CC1 |
| InChI | InChI=1S/C12H8Br2O.C12H23P/c13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)14;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-8H;11-13H,1-10H2 |
| InChIKey | KXLJYCPIXQRNBK-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 526.29 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2-(2-bromophenoxy)benzene;dicyclohexylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-(2-bromophenoxy)benzene;dicyclohexylphosphane?
The IUPAC name of 1-bromo-2-(2-bromophenoxy)benzene;dicyclohexylphosphane (CID 155269265) is 1-bromo-2-(2-bromophenoxy)benzene;dicyclohexylphosphane.
What is the SMILES notation for 1-bromo-2-(2-bromophenoxy)benzene;dicyclohexylphosphane?
The canonical SMILES for 1-bromo-2-(2-bromophenoxy)benzene;dicyclohexylphosphane is Brc1ccccc1Oc1ccccc1Br.C1CCC(PC2CCCCC2)CC1.
What is the InChIKey of 1-bromo-2-(2-bromophenoxy)benzene;dicyclohexylphosphane?
The InChIKey is KXLJYCPIXQRNBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Br2O.C12H23P/c13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)14;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-8H;11-13H,1-10H2.
What are the key properties of 1-bromo-2-(2-bromophenoxy)benzene;dicyclohexylphosphane?
1-bromo-2-(2-bromophenoxy)benzene;dicyclohexylphosphane has a molecular weight of 526.29 g/mol, XLogP of 9.33, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-(2-bromophenoxy)benzene;dicyclohexylphosphane is sourced from PubChem (CID 155269265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).