About di(cyclodecyl)phosphane
di(cyclodecyl)phosphane (PubChem CID 18705980) has the molecular formula C20H39P
and a molecular weight of 310.51 g/mol. Its IUPAC name is di(cyclodecyl)phosphane.
Molecular Properties
| Compound Name | di(cyclodecyl)phosphane |
| PubChem CID | 18705980 |
| Molecular Formula | C20H39P |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.28 |
| IUPAC Name | di(cyclodecyl)phosphane |
| SMILES | C1CCCCC(PC2CCCCCCCCC2)CCCC1 |
| InChI | InChI=1S/C20H39P/c1-3-7-11-15-19(16-12-8-4-1)21-20-17-13-9-5-2-6-10-14-18-20/h19-21H,1-18H2 |
| InChIKey | FIMNXXUFDXYSQF-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze di(cyclodecyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(cyclodecyl)phosphane?
The IUPAC name of di(cyclodecyl)phosphane (CID 18705980) is di(cyclodecyl)phosphane.
What is the SMILES notation for di(cyclodecyl)phosphane?
The canonical SMILES for di(cyclodecyl)phosphane is C1CCCCC(PC2CCCCCCCCC2)CCCC1.
What is the InChIKey of di(cyclodecyl)phosphane?
The InChIKey is FIMNXXUFDXYSQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H39P/c1-3-7-11-15-19(16-12-8-4-1)21-20-17-13-9-5-2-6-10-14-18-20/h19-21H,1-18H2.
What are the key properties of di(cyclodecyl)phosphane?
di(cyclodecyl)phosphane has a molecular weight of 310.51 g/mol, XLogP of 7.45, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for di(cyclodecyl)phosphane is sourced from PubChem (CID 18705980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).