About dicyclohexylphosphane;thiophene
dicyclohexylphosphane;thiophene (PubChem CID 157393395) has the molecular formula C16H27PS
and a molecular weight of 282.43 g/mol. Its IUPAC name is dicyclohexylphosphane;thiophene.
Molecular Properties
| Compound Name | dicyclohexylphosphane;thiophene |
| PubChem CID | 157393395 |
| Molecular Formula | C16H27PS |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | dicyclohexylphosphane;thiophene |
| SMILES | C1CCC(PC2CCCCC2)CC1.c1ccsc1 |
| InChI | InChI=1S/C12H23P.C4H4S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-4-5-3-1/h11-13H,1-10H2;1-4H |
| InChIKey | BMGZBKVDWJCETD-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dicyclohexylphosphane;thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicyclohexylphosphane;thiophene?
The IUPAC name of dicyclohexylphosphane;thiophene (CID 157393395) is dicyclohexylphosphane;thiophene.
What is the SMILES notation for dicyclohexylphosphane;thiophene?
The canonical SMILES for dicyclohexylphosphane;thiophene is C1CCC(PC2CCCCC2)CC1.c1ccsc1.
What is the InChIKey of dicyclohexylphosphane;thiophene?
The InChIKey is BMGZBKVDWJCETD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23P.C4H4S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-4-5-3-1/h11-13H,1-10H2;1-4H.
What are the key properties of dicyclohexylphosphane;thiophene?
dicyclohexylphosphane;thiophene has a molecular weight of 282.43 g/mol, XLogP of 6.08, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dicyclohexylphosphane;thiophene is sourced from PubChem (CID 157393395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).