About dicyclohexylphosphane;iodomercury
dicyclohexylphosphane;iodomercury (PubChem CID 13153740) has the molecular formula C12H23HgIP
and a molecular weight of 525.78 g/mol. Its IUPAC name is dicyclohexylphosphane;iodomercury.
Molecular Properties
| Compound Name | dicyclohexylphosphane;iodomercury |
| PubChem CID | 13153740 |
| Molecular Formula | C12H23HgIP |
| Molecular Weight | 525.78 g/mol |
| Exact Mass | 527.03 |
| IUPAC Name | dicyclohexylphosphane;iodomercury |
| SMILES | C1CCC(PC2CCCCC2)CC1.I[Hg] |
| InChI | InChI=1S/C12H23P.Hg.HI/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;;/h11-13H,1-10H2;;1H/q;+1;/p-1 |
| InChIKey | YPORTARVFZICPR-UHFFFAOYSA-M |
| XLogP | 5.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 525.78 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dicyclohexylphosphane;iodomercury with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicyclohexylphosphane;iodomercury?
The IUPAC name of dicyclohexylphosphane;iodomercury (CID 13153740) is dicyclohexylphosphane;iodomercury.
What is the SMILES notation for dicyclohexylphosphane;iodomercury?
The canonical SMILES for dicyclohexylphosphane;iodomercury is C1CCC(PC2CCCCC2)CC1.I[Hg].
What is the InChIKey of dicyclohexylphosphane;iodomercury?
The InChIKey is YPORTARVFZICPR-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H23P.Hg.HI/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;;/h11-13H,1-10H2;;1H/q;+1;/p-1.
What are the key properties of dicyclohexylphosphane;iodomercury?
dicyclohexylphosphane;iodomercury has a molecular weight of 525.78 g/mol, XLogP of 5.21, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dicyclohexylphosphane;iodomercury is sourced from PubChem (CID 13153740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).