About dicyclohexylphosphane;gold
dicyclohexylphosphane;gold (PubChem CID 167367243) has the molecular formula C12H23AuP
and a molecular weight of 395.26 g/mol. Its IUPAC name is dicyclohexylphosphane;gold.
Molecular Properties
| Compound Name | dicyclohexylphosphane;gold |
| PubChem CID | 167367243 |
| Molecular Formula | C12H23AuP |
| Molecular Weight | 395.26 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | dicyclohexylphosphane;gold |
| SMILES | C1CCC(PC2CCCCC2)CC1.[Au] |
| InChI | InChI=1S/C12H23P.Au/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;/h11-13H,1-10H2; |
| InChIKey | INYQIHMIQQFKJY-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.26 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dicyclohexylphosphane;gold with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicyclohexylphosphane;gold?
The IUPAC name of dicyclohexylphosphane;gold (CID 167367243) is dicyclohexylphosphane;gold.
What is the SMILES notation for dicyclohexylphosphane;gold?
The canonical SMILES for dicyclohexylphosphane;gold is C1CCC(PC2CCCCC2)CC1.[Au].
What is the InChIKey of dicyclohexylphosphane;gold?
The InChIKey is INYQIHMIQQFKJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23P.Au/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;/h11-13H,1-10H2;.
What are the key properties of dicyclohexylphosphane;gold?
dicyclohexylphosphane;gold has a molecular weight of 395.26 g/mol, XLogP of 4.33, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dicyclohexylphosphane;gold is sourced from PubChem (CID 167367243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).