About dicyclopentylphosphane
dicyclopentylphosphane (PubChem CID 550272) has the molecular formula C10H19P
and a molecular weight of 170.24 g/mol. Its IUPAC name is dicyclopentylphosphane.
Molecular Properties
| Compound Name | dicyclopentylphosphane |
| PubChem CID | 550272 |
| Molecular Formula | C10H19P |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | dicyclopentylphosphane |
| SMILES | C1CCC(PC2CCCC2)C1 |
| InChI | InChI=1S/C10H19P/c1-2-6-9(5-1)11-10-7-3-4-8-10/h9-11H,1-8H2 |
| InChIKey | OKMVYXTWPPPSIM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dicyclopentylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicyclopentylphosphane?
The IUPAC name of dicyclopentylphosphane (CID 550272) is dicyclopentylphosphane.
What is the SMILES notation for dicyclopentylphosphane?
The canonical SMILES for dicyclopentylphosphane is C1CCC(PC2CCCC2)C1.
What is the InChIKey of dicyclopentylphosphane?
The InChIKey is OKMVYXTWPPPSIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19P/c1-2-6-9(5-1)11-10-7-3-4-8-10/h9-11H,1-8H2.
What are the key properties of dicyclopentylphosphane?
dicyclopentylphosphane has a molecular weight of 170.24 g/mol, XLogP of 3.55, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dicyclopentylphosphane is sourced from PubChem (CID 550272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).