C19H23N — CID 155273895
(E)-3-[3-[(3Z)-3,4-dimethylhepta-1,3-dien-6-yn-2-yl]phenyl]but-2-en-1-amine (PubChem CID 155273895) has the molecular formula C19H23N and a molecular weight of 265.40 g/mol. Its IUPAC name is (E)-3-[3-[(3Z)-3,4-dimethylhepta-1,3-dien-6-yn-2-yl]phenyl]but-2-en-1-amine.
| Compound Name | (E)-3-[3-[(3Z)-3,4-dimethylhepta-1,3-dien-6-yn-2-yl]phenyl]but-2-en-1-amine |
|---|---|
| PubChem CID | 155273895 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | (E)-3-[3-[(3Z)-3,4-dimethylhepta-1,3-dien-6-yn-2-yl]phenyl]but-2-en-1-amine |
| SMILES | C#CC/C(C)=C(/C)C(=C)c1cccc(/C(C)=C/CN)c1 |
| InChI | InChI=1S/C19H23N/c1-6-8-14(2)16(4)17(5)19-10-7-9-18(13-19)15(3)11-12-20/h1,7,9-11,13H,5,8,12,20H2,2-4H3/b15-11+,16-14- |
| InChIKey | GBMLCYKEHVVVBK-RBYPTUOBSA-N |
| XLogP | 4.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|