C26H60Si5 — CID 15527540
trimethyl-[2-[trimethylsilyl-bis[tri(propan-2-yl)silyl]silyl]ethynyl]silane (PubChem CID 15527540) has the molecular formula C26H60Si5 and a molecular weight of 513.20 g/mol. Its IUPAC name is trimethyl-[2-[trimethylsilyl-bis[tri(propan-2-yl)silyl]silyl]ethynyl]silane.
| Compound Name | trimethyl-[2-[trimethylsilyl-bis[tri(propan-2-yl)silyl]silyl]ethynyl]silane |
|---|---|
| PubChem CID | 15527540 |
| Molecular Formula | C26H60Si5 |
| Molecular Weight | 513.20 g/mol |
| Exact Mass | 512.35 |
| IUPAC Name | trimethyl-[2-[trimethylsilyl-bis[tri(propan-2-yl)silyl]silyl]ethynyl]silane |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)[Si](C#C[Si](C)(C)C)([Si](C)(C)C)[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H60Si5/c1-21(2)30(22(3)4,23(5)6)29(28(16,17)18,20-19-27(13,14)15)31(24(7)8,25(9)10)26(11)12/h21-26H,1-18H3 |
| InChIKey | UUTNPBYVMMHQPG-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.20 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|