C22H40O2Si2 — CID 10596713
2-[5,5-dimethyl-2-(2-trimethylsilylethynyl)-1,3-dioxan-2-yl]ethynyl-tri(propan-2-yl)silane (PubChem CID 10596713) has the molecular formula C22H40O2Si2 and a molecular weight of 392.73 g/mol. Its IUPAC name is 2-[5,5-dimethyl-2-(2-trimethylsilylethynyl)-1,3-dioxan-2-yl]ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-[5,5-dimethyl-2-(2-trimethylsilylethynyl)-1,3-dioxan-2-yl]ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 10596713 |
| Molecular Formula | C22H40O2Si2 |
| Molecular Weight | 392.73 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | 2-[5,5-dimethyl-2-(2-trimethylsilylethynyl)-1,3-dioxan-2-yl]ethynyl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#CC1(C#C[Si](C)(C)C)OCC(C)(C)CO1)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H40O2Si2/c1-18(2)26(19(3)4,20(5)6)15-13-22(12-14-25(9,10)11)23-16-21(7,8)17-24-22/h18-20H,16-17H2,1-11H3 |
| InChIKey | JNJJTQZDVUVKIX-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.73 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|