C21H39BrO2Si — CID 166637290
[3-bromo-6-(5,5-dimethyl-1,3-dioxan-2-yl)hex-1-ynyl]-tri(propan-2-yl)silane (PubChem CID 166637290) has the molecular formula C21H39BrO2Si and a molecular weight of 431.53 g/mol. Its IUPAC name is [3-bromo-6-(5,5-dimethyl-1,3-dioxan-2-yl)hex-1-ynyl]-tri(propan-2-yl)silane.
| Compound Name | [3-bromo-6-(5,5-dimethyl-1,3-dioxan-2-yl)hex-1-ynyl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 166637290 |
| Molecular Formula | C21H39BrO2Si |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | [3-bromo-6-(5,5-dimethyl-1,3-dioxan-2-yl)hex-1-ynyl]-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#CC(Br)CCCC1OCC(C)(C)CO1)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H39BrO2Si/c1-16(2)25(17(3)4,18(5)6)13-12-19(22)10-9-11-20-23-14-21(7,8)15-24-20/h16-20H,9-11,14-15H2,1-8H3 |
| InChIKey | MPAJRDFPWIDCBW-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|