C17H21N — CID 155275528
(E)-N-ethenyl-2-[2-(3-methylbuta-1,3-dien-2-yl)phenyl]but-1-en-1-amine (PubChem CID 155275528) has the molecular formula C17H21N and a molecular weight of 239.36 g/mol. Its IUPAC name is (E)-N-ethenyl-2-[2-(3-methylbuta-1,3-dien-2-yl)phenyl]but-1-en-1-amine.
| Compound Name | (E)-N-ethenyl-2-[2-(3-methylbuta-1,3-dien-2-yl)phenyl]but-1-en-1-amine |
|---|---|
| PubChem CID | 155275528 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | (E)-N-ethenyl-2-[2-(3-methylbuta-1,3-dien-2-yl)phenyl]but-1-en-1-amine |
| SMILES | C=CN/C=C(\CC)c1ccccc1C(=C)C(=C)C |
| InChI | InChI=1S/C17H21N/c1-6-15(12-18-7-2)17-11-9-8-10-16(17)14(5)13(3)4/h7-12,18H,2-3,5-6H2,1,4H3/b15-12+ |
| InChIKey | UWOSFDJVTILSNB-NTCAYCPXSA-N |
| XLogP | 4.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|