C32H25F2N4O3P — CID 155276575
1-N'-[3-fluoro-4-[[7-(3-fluoro-4-phosphanylphenyl)-1,6-naphthyridin-4-yl]oxy]phenyl]-1-N-(4-methylphenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 155276575) has the molecular formula C32H25F2N4O3P and a molecular weight of 582.55 g/mol. Its IUPAC name is 1-N'-[3-fluoro-4-[[7-(3-fluoro-4-phosphanylphenyl)-1,6-naphthyridin-4-yl]oxy]phenyl]-1-N-(4-methylphenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[3-fluoro-4-[[7-(3-fluoro-4-phosphanylphenyl)-1,6-naphthyridin-4-yl]oxy]phenyl]-1-N-(4-methylphenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 155276575 |
| Molecular Formula | C32H25F2N4O3P |
| Molecular Weight | 582.55 g/mol |
| Exact Mass | 582.16 |
| IUPAC Name | 1-N'-[3-fluoro-4-[[7-(3-fluoro-4-phosphanylphenyl)-1,6-naphthyridin-4-yl]oxy]phenyl]-1-N-(4-methylphenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)C2(C(=O)Nc3ccc(Oc4ccnc5cc(-c6ccc(P)c(F)c6)ncc45)c(F)c3)CC2)cc1 |
| InChI | InChI=1S/C32H25F2N4O3P/c1-18-2-5-20(6-3-18)37-30(39)32(11-12-32)31(40)38-21-7-8-28(23(33)15-21)41-27-10-13-35-26-16-25(36-17-22(26)27)19-4-9-29(42)24(34)14-19/h2-10,13-17H,11-12,42H2,1H3,(H,37,39)(H,38,40) |
| InChIKey | CEQWUKLZMUBQPZ-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.55 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|