C17H21F3N2O3 — CID 155277076
tert-butyl (2S,3S)-2-methyl-3-[(3,4,5-trifluorophenyl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 155277076) has the molecular formula C17H21F3N2O3 and a molecular weight of 358.36 g/mol. Its IUPAC name is tert-butyl (2S,3S)-2-methyl-3-[(3,4,5-trifluorophenyl)carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3S)-2-methyl-3-[(3,4,5-trifluorophenyl)carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 155277076 |
| Molecular Formula | C17H21F3N2O3 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | tert-butyl (2S,3S)-2-methyl-3-[(3,4,5-trifluorophenyl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | C[C@H]1[C@@H](C(=O)Nc2cc(F)c(F)c(F)c2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H21F3N2O3/c1-9-11(5-6-22(9)16(24)25-17(2,3)4)15(23)21-10-7-12(18)14(20)13(19)8-10/h7-9,11H,5-6H2,1-4H3,(H,21,23)/t9-,11-/m0/s1 |
| InChIKey | XXYKTTZXNROHCC-ONGXEEELSA-N |
| XLogP | 3.69 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|