C26H22ClN — CID 155284942
5-chloro-2-(3,6,9,9-tetramethylfluoren-1-yl)quinoline (PubChem CID 155284942) has the molecular formula C26H22ClN and a molecular weight of 383.92 g/mol. Its IUPAC name is 5-chloro-2-(3,6,9,9-tetramethylfluoren-1-yl)quinoline.
| Compound Name | 5-chloro-2-(3,6,9,9-tetramethylfluoren-1-yl)quinoline |
|---|---|
| PubChem CID | 155284942 |
| Molecular Formula | C26H22ClN |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 5-chloro-2-(3,6,9,9-tetramethylfluoren-1-yl)quinoline |
| SMILES | Cc1ccc2c(c1)-c1cc(C)cc(-c3ccc4c(Cl)cccc4n3)c1C2(C)C |
| InChI | InChI=1S/C26H22ClN/c1-15-8-10-21-18(12-15)19-13-16(2)14-20(25(19)26(21,3)4)24-11-9-17-22(27)6-5-7-23(17)28-24/h5-14H,1-4H3 |
| InChIKey | UTKIBJKPGIUPHF-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |