C27H22FN3O3 — CID 155284967
4-[5-(4-fluorophenyl)-6-(oxan-3-yl)-1H-pyrrolo[2,3-f]indazol-7-yl]benzoic acid (PubChem CID 155284967) has the molecular formula C27H22FN3O3 and a molecular weight of 455.49 g/mol. Its IUPAC name is 4-[5-(4-fluorophenyl)-6-(oxan-3-yl)-1H-pyrrolo[2,3-f]indazol-7-yl]benzoic acid.
| Compound Name | 4-[5-(4-fluorophenyl)-6-(oxan-3-yl)-1H-pyrrolo[2,3-f]indazol-7-yl]benzoic acid |
|---|---|
| PubChem CID | 155284967 |
| Molecular Formula | C27H22FN3O3 |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 4-[5-(4-fluorophenyl)-6-(oxan-3-yl)-1H-pyrrolo[2,3-f]indazol-7-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2c(C3CCCOC3)n(-c3ccc(F)cc3)c3cc4cn[nH]c4cc23)cc1 |
| InChI | InChI=1S/C27H22FN3O3/c28-20-7-9-21(10-8-20)31-24-12-19-14-29-30-23(19)13-22(24)25(26(31)18-2-1-11-34-15-18)16-3-5-17(6-4-16)27(32)33/h3-10,12-14,18H,1-2,11,15H2,(H,29,30)(H,32,33) |
| InChIKey | FFDCTEBNTMKTMX-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |