C30H28ClFN4O2 — CID 155285122
1-[7-(6-chloro-3-pyridinyl)-5-(4-fluorophenyl)-6-(oxan-4-yl)pyrrolo[2,3-f]indazol-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 155285122) has the molecular formula C30H28ClFN4O2 and a molecular weight of 531.03 g/mol. Its IUPAC name is 1-[7-(6-chloro-3-pyridinyl)-5-(4-fluorophenyl)-6-(oxan-4-yl)pyrrolo[2,3-f]indazol-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[7-(6-chloro-3-pyridinyl)-5-(4-fluorophenyl)-6-(oxan-4-yl)pyrrolo[2,3-f]indazol-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 155285122 |
| Molecular Formula | C30H28ClFN4O2 |
| Molecular Weight | 531.03 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | 1-[7-(6-chloro-3-pyridinyl)-5-(4-fluorophenyl)-6-(oxan-4-yl)pyrrolo[2,3-f]indazol-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)n1ncc2cc3c(cc21)c(-c1ccc(Cl)nc1)c(C1CCOCC1)n3-c1ccc(F)cc1 |
| InChI | InChI=1S/C30H28ClFN4O2/c1-30(2,3)29(37)36-24-15-23-25(14-20(24)17-34-36)35(22-7-5-21(32)6-8-22)28(18-10-12-38-13-11-18)27(23)19-4-9-26(31)33-16-19/h4-9,14-18H,10-13H2,1-3H3 |
| InChIKey | ILKHCUOUQUGTMV-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.03 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|