C26H27FIN3O2 — CID 155318083
1-[5-(4-fluorophenyl)-7-iodo-6-(4-methyloxan-4-yl)pyrrolo[2,3-f]indazol-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 155318083) has the molecular formula C26H27FIN3O2 and a molecular weight of 559.42 g/mol. Its IUPAC name is 1-[5-(4-fluorophenyl)-7-iodo-6-(4-methyloxan-4-yl)pyrrolo[2,3-f]indazol-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[5-(4-fluorophenyl)-7-iodo-6-(4-methyloxan-4-yl)pyrrolo[2,3-f]indazol-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 155318083 |
| Molecular Formula | C26H27FIN3O2 |
| Molecular Weight | 559.42 g/mol |
| Exact Mass | 559.11 |
| IUPAC Name | 1-[5-(4-fluorophenyl)-7-iodo-6-(4-methyloxan-4-yl)pyrrolo[2,3-f]indazol-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)n1ncc2cc3c(cc21)c(I)c(C1(C)CCOCC1)n3-c1ccc(F)cc1 |
| InChI | InChI=1S/C26H27FIN3O2/c1-25(2,3)24(32)31-20-14-19-21(13-16(20)15-29-31)30(18-7-5-17(27)6-8-18)23(22(19)28)26(4)9-11-33-12-10-26/h5-8,13-15H,9-12H2,1-4H3 |
| InChIKey | ULJZFLBQZCGCHP-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.42 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|