C33H32FN3O4 — CID 155640257
methyl 4-[1-(2,2-dimethylpropanoyl)-5-(4-fluorophenyl)-6-(3,3,4,5,5-pentadeuteriooxan-4-yl)pyrrolo[2,3-f]indazol-7-yl]benzoate (PubChem CID 155640257) has the molecular formula C33H32FN3O4 and a molecular weight of 558.66 g/mol. Its IUPAC name is methyl 4-[1-(2,2-dimethylpropanoyl)-5-(4-fluorophenyl)-6-(3,3,4,5,5-pentadeuteriooxan-4-yl)pyrrolo[2,3-f]indazol-7-yl]benzoate.
| Compound Name | methyl 4-[1-(2,2-dimethylpropanoyl)-5-(4-fluorophenyl)-6-(3,3,4,5,5-pentadeuteriooxan-4-yl)pyrrolo[2,3-f]indazol-7-yl]benzoate |
|---|---|
| PubChem CID | 155640257 |
| Molecular Formula | C33H32FN3O4 |
| Molecular Weight | 558.66 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | methyl 4-[1-(2,2-dimethylpropanoyl)-5-(4-fluorophenyl)-6-(3,3,4,5,5-pentadeuteriooxan-4-yl)pyrrolo[2,3-f]indazol-7-yl]benzoate |
| SMILES | [2H]C1([2H])COCC([2H])([2H])C1([2H])c1c(-c2ccc(C(=O)OC)cc2)c2cc3c(cnn3C(=O)C(C)(C)C)cc2n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C33H32FN3O4/c1-33(2,3)32(39)37-27-18-26-28(17-23(27)19-35-37)36(25-11-9-24(34)10-12-25)30(21-13-15-41-16-14-21)29(26)20-5-7-22(8-6-20)31(38)40-4/h5-12,17-19,21H,13-16H2,1-4H3/i13D2,14D2,21D |
| InChIKey | HIGCDPFOUYIWHQ-GQDOFENUSA-N |
| XLogP | 7.15 |
| TPSA | 75.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.66 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |