C8H8FN3S — CID 155292846
5-(4-fluorophenyl)-1,2,4-triazolidine-3-thione (PubChem CID 155292846) has the molecular formula C8H8FN3S and a molecular weight of 197.24 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-1,2,4-triazolidine-3-thione.
| Compound Name | 5-(4-fluorophenyl)-1,2,4-triazolidine-3-thione |
|---|---|
| PubChem CID | 155292846 |
| Molecular Formula | C8H8FN3S |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 5-(4-fluorophenyl)-1,2,4-triazolidine-3-thione |
| SMILES | Fc1ccc(C2NNC(=S)N2)cc1 |
| InChI | InChI=1S/C8H8FN3S/c9-6-3-1-5(2-4-6)7-10-8(13)12-11-7/h1-4,7,11H,(H2,10,12,13) |
| InChIKey | HKIKGXDSCYBOOS-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|