C26H34N6O3 — CID 155309755
tert-butyl 4-[4-amino-6-[4-(1-hydroxyprop-2-enylamino)phenyl]-7-methylpyrrolo[2,3-d]pyrimidin-5-yl]piperidine-1-carboxylate (PubChem CID 155309755) has the molecular formula C26H34N6O3 and a molecular weight of 478.60 g/mol. Its IUPAC name is tert-butyl 4-[4-amino-6-[4-(1-hydroxyprop-2-enylamino)phenyl]-7-methylpyrrolo[2,3-d]pyrimidin-5-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-amino-6-[4-(1-hydroxyprop-2-enylamino)phenyl]-7-methylpyrrolo[2,3-d]pyrimidin-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155309755 |
| Molecular Formula | C26H34N6O3 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | tert-butyl 4-[4-amino-6-[4-(1-hydroxyprop-2-enylamino)phenyl]-7-methylpyrrolo[2,3-d]pyrimidin-5-yl]piperidine-1-carboxylate |
| SMILES | C=CC(O)Nc1ccc(-c2c(C3CCN(C(=O)OC(C)(C)C)CC3)c3c(N)ncnc3n2C)cc1 |
| InChI | InChI=1S/C26H34N6O3/c1-6-19(33)30-18-9-7-17(8-10-18)22-20(21-23(27)28-15-29-24(21)31(22)5)16-11-13-32(14-12-16)25(34)35-26(2,3)4/h6-10,15-16,19,30,33H,1,11-14H2,2-5H3,(H2,27,28,29) |
| InChIKey | GJOOVSZSRLMREG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 118.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|