C21H18N6O2 — CID 169422773
N-[4-[4-amino-7-methyl-5-(6-oxo-3H-pyridin-3-yl)pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]prop-2-enamide (PubChem CID 169422773) has the molecular formula C21H18N6O2 and a molecular weight of 386.42 g/mol. Its IUPAC name is N-[4-[4-amino-7-methyl-5-(6-oxo-3H-pyridin-3-yl)pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]prop-2-enamide.
| Compound Name | N-[4-[4-amino-7-methyl-5-(6-oxo-3H-pyridin-3-yl)pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 169422773 |
| Molecular Formula | C21H18N6O2 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | N-[4-[4-amino-7-methyl-5-(6-oxo-3H-pyridin-3-yl)pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(-c2c(C3C=CC(=O)N=C3)c3c(N)ncnc3n2C)cc1 |
| InChI | InChI=1S/C21H18N6O2/c1-3-15(28)26-14-7-4-12(5-8-14)19-17(13-6-9-16(29)23-10-13)18-20(22)24-11-25-21(18)27(19)2/h3-11,13H,1H2,2H3,(H,26,28)(H2,22,24,25) |
| InChIKey | OXVXFUIPVNRIAY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 115.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|