C26H25ClN4O3S2 — CID 155310625
N-[4-[4-(4-chlorobenzoyl)piperidin-1-yl]phenyl]-2-(2-hydroxyethylamino)thieno[2,3-d][1,3]thiazole-5-carboxamide (PubChem CID 155310625) has the molecular formula C26H25ClN4O3S2 and a molecular weight of 541.10 g/mol. Its IUPAC name is N-[4-[4-(4-chlorobenzoyl)piperidin-1-yl]phenyl]-2-(2-hydroxyethylamino)thieno[2,3-d][1,3]thiazole-5-carboxamide.
| Compound Name | N-[4-[4-(4-chlorobenzoyl)piperidin-1-yl]phenyl]-2-(2-hydroxyethylamino)thieno[2,3-d][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 155310625 |
| Molecular Formula | C26H25ClN4O3S2 |
| Molecular Weight | 541.10 g/mol |
| Exact Mass | 540.11 |
| IUPAC Name | N-[4-[4-(4-chlorobenzoyl)piperidin-1-yl]phenyl]-2-(2-hydroxyethylamino)thieno[2,3-d][1,3]thiazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCC(C(=O)c3ccc(Cl)cc3)CC2)cc1)c1cc2sc(NCCO)nc2s1 |
| InChI | InChI=1S/C26H25ClN4O3S2/c27-18-3-1-16(2-4-18)23(33)17-9-12-31(13-10-17)20-7-5-19(6-8-20)29-24(34)21-15-22-25(35-21)30-26(36-22)28-11-14-32/h1-8,15,17,32H,9-14H2,(H,28,30)(H,29,34) |
| InChIKey | JWMNEXLOBKKJSI-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.10 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|