C25H24N4O3S2 — CID 155311414
2-[2-(2-hydroxyethylamino)ethylamino]-N-[4-(4-prop-2-ynoxyphenyl)phenyl]thieno[2,3-d][1,3]thiazole-5-carboxamide (PubChem CID 155311414) has the molecular formula C25H24N4O3S2 and a molecular weight of 492.63 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethylamino)ethylamino]-N-[4-(4-prop-2-ynoxyphenyl)phenyl]thieno[2,3-d][1,3]thiazole-5-carboxamide.
| Compound Name | 2-[2-(2-hydroxyethylamino)ethylamino]-N-[4-(4-prop-2-ynoxyphenyl)phenyl]thieno[2,3-d][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 155311414 |
| Molecular Formula | C25H24N4O3S2 |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | 2-[2-(2-hydroxyethylamino)ethylamino]-N-[4-(4-prop-2-ynoxyphenyl)phenyl]thieno[2,3-d][1,3]thiazole-5-carboxamide |
| SMILES | C#CCOc1ccc(-c2ccc(NC(=O)c3cc4sc(NCCNCCO)nc4s3)cc2)cc1 |
| InChI | InChI=1S/C25H24N4O3S2/c1-2-15-32-20-9-5-18(6-10-20)17-3-7-19(8-4-17)28-23(31)21-16-22-24(33-21)29-25(34-22)27-12-11-26-13-14-30/h1,3-10,16,26,30H,11-15H2,(H,27,29)(H,28,31) |
| InChIKey | PWHCZNJDDLUHSB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 95.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|