C21H18FN3O2 — CID 155319217
1-[3-[3-(2-fluoro-6-hydroxyphenyl)-1,6-naphthyridin-7-yl]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 155319217) has the molecular formula C21H18FN3O2 and a molecular weight of 363.39 g/mol. Its IUPAC name is 1-[3-[3-(2-fluoro-6-hydroxyphenyl)-1,6-naphthyridin-7-yl]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[3-(2-fluoro-6-hydroxyphenyl)-1,6-naphthyridin-7-yl]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155319217 |
| Molecular Formula | C21H18FN3O2 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 1-[3-[3-(2-fluoro-6-hydroxyphenyl)-1,6-naphthyridin-7-yl]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(c2cc3ncc(-c4c(O)cccc4F)cc3cn2)C1 |
| InChI | InChI=1S/C21H18FN3O2/c1-2-20(27)25-7-6-13(12-25)17-9-18-14(10-23-17)8-15(11-24-18)21-16(22)4-3-5-19(21)26/h2-5,8-11,13,26H,1,6-7,12H2 |
| InChIKey | GUYVYTUDIFNICV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|