C22H21FN4O5 — CID 155319327
2-[3-[4-[(3aR,6aS)-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-d][1,3]oxazol-5-yl]-3-fluoroanilino]-2-hydroxypropyl]isoindole-1,3-dione (PubChem CID 155319327) has the molecular formula C22H21FN4O5 and a molecular weight of 440.43 g/mol. Its IUPAC name is 2-[3-[4-[(3aR,6aS)-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-d][1,3]oxazol-5-yl]-3-fluoroanilino]-2-hydroxypropyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[4-[(3aR,6aS)-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-d][1,3]oxazol-5-yl]-3-fluoroanilino]-2-hydroxypropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 155319327 |
| Molecular Formula | C22H21FN4O5 |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 2-[3-[4-[(3aR,6aS)-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-d][1,3]oxazol-5-yl]-3-fluoroanilino]-2-hydroxypropyl]isoindole-1,3-dione |
| SMILES | O=C1N[C@@H]2CN(c3ccc(NCC(O)CN4C(=O)c5ccccc5C4=O)cc3F)C[C@@H]2O1 |
| InChI | InChI=1S/C22H21FN4O5/c23-16-7-12(5-6-18(16)26-10-17-19(11-26)32-22(31)25-17)24-8-13(28)9-27-20(29)14-3-1-2-4-15(14)21(27)30/h1-7,13,17,19,24,28H,8-11H2,(H,25,31)/t13?,17-,19+/m1/s1 |
| InChIKey | OLSWCPBMHCTOBQ-XGENFCTJSA-N |
| XLogP | 1.19 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|