C22H28FN3O5S — CID 155319489
N-[[(5S)-3-[4-(6,6-dioxo-1,3,3a,4,5,7,8,8a-octahydrothiepino[4,5-c]pyrrol-2-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]cyclopropanecarboxamide (PubChem CID 155319489) has the molecular formula C22H28FN3O5S and a molecular weight of 465.55 g/mol. Its IUPAC name is N-[[(5S)-3-[4-(6,6-dioxo-1,3,3a,4,5,7,8,8a-octahydrothiepino[4,5-c]pyrrol-2-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]cyclopropanecarboxamide.
| Compound Name | N-[[(5S)-3-[4-(6,6-dioxo-1,3,3a,4,5,7,8,8a-octahydrothiepino[4,5-c]pyrrol-2-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 155319489 |
| Molecular Formula | C22H28FN3O5S |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | N-[[(5S)-3-[4-(6,6-dioxo-1,3,3a,4,5,7,8,8a-octahydrothiepino[4,5-c]pyrrol-2-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]cyclopropanecarboxamide |
| SMILES | O=C(NC[C@H]1CN(c2ccc(N3CC4CCS(=O)(=O)CCC4C3)c(F)c2)C(=O)O1)C1CC1 |
| InChI | InChI=1S/C22H28FN3O5S/c23-19-9-17(26-13-18(31-22(26)28)10-24-21(27)14-1-2-14)3-4-20(19)25-11-15-5-7-32(29,30)8-6-16(15)12-25/h3-4,9,14-16,18H,1-2,5-8,10-13H2,(H,24,27)/t15?,16?,18-/m0/s1 |
| InChIKey | VIZXLRZKUZMXCJ-HTWSVDAQSA-N |
| XLogP | 1.94 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|