C22H27F2N3O5S — CID 155725049
N-[[(5S)-3-[4-(6,6-dioxo-1,3,3a,4,5,7,8,8a-octahydrothiepino[4,5-c]pyrrol-2-yl)-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]cyclopropanecarboxamide (PubChem CID 155725049) has the molecular formula C22H27F2N3O5S and a molecular weight of 483.54 g/mol. Its IUPAC name is N-[[(5S)-3-[4-(6,6-dioxo-1,3,3a,4,5,7,8,8a-octahydrothiepino[4,5-c]pyrrol-2-yl)-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]cyclopropanecarboxamide.
| Compound Name | N-[[(5S)-3-[4-(6,6-dioxo-1,3,3a,4,5,7,8,8a-octahydrothiepino[4,5-c]pyrrol-2-yl)-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 155725049 |
| Molecular Formula | C22H27F2N3O5S |
| Molecular Weight | 483.54 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | N-[[(5S)-3-[4-(6,6-dioxo-1,3,3a,4,5,7,8,8a-octahydrothiepino[4,5-c]pyrrol-2-yl)-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]cyclopropanecarboxamide |
| SMILES | O=C(NC[C@H]1CN(c2cc(F)c(N3CC4CCS(=O)(=O)CCC4C3)c(F)c2)C(=O)O1)C1CC1 |
| InChI | InChI=1S/C22H27F2N3O5S/c23-18-7-16(27-12-17(32-22(27)29)9-25-21(28)13-1-2-13)8-19(24)20(18)26-10-14-3-5-33(30,31)6-4-15(14)11-26/h7-8,13-15,17H,1-6,9-12H2,(H,25,28)/t14?,15?,17-/m0/s1 |
| InChIKey | GNHYRUNXJHQBDB-DQPZFDDXSA-N |
| XLogP | 2.08 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.54 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|