C31H39NO2 — CID 155322097
6-[(3aR,6S)-6-amino-3-phenyl-3a-(1-phenylethenyl)-4,5,6,6a-tetrahydro-1H-pentalen-2-yl]-3,5,5-trimethylhexanoic acid (PubChem CID 155322097) has the molecular formula C31H39NO2 and a molecular weight of 457.66 g/mol. Its IUPAC name is 6-[(3aR,6S)-6-amino-3-phenyl-3a-(1-phenylethenyl)-4,5,6,6a-tetrahydro-1H-pentalen-2-yl]-3,5,5-trimethylhexanoic acid.
| Compound Name | 6-[(3aR,6S)-6-amino-3-phenyl-3a-(1-phenylethenyl)-4,5,6,6a-tetrahydro-1H-pentalen-2-yl]-3,5,5-trimethylhexanoic acid |
|---|---|
| PubChem CID | 155322097 |
| Molecular Formula | C31H39NO2 |
| Molecular Weight | 457.66 g/mol |
| Exact Mass | 457.30 |
| IUPAC Name | 6-[(3aR,6S)-6-amino-3-phenyl-3a-(1-phenylethenyl)-4,5,6,6a-tetrahydro-1H-pentalen-2-yl]-3,5,5-trimethylhexanoic acid |
| SMILES | C=C(c1ccccc1)[C@@]12CC[C@H](N)C1CC(CC(C)(C)CC(C)CC(=O)O)=C2c1ccccc1 |
| InChI | InChI=1S/C31H39NO2/c1-21(17-28(33)34)19-30(3,4)20-25-18-26-27(32)15-16-31(26,22(2)23-11-7-5-8-12-23)29(25)24-13-9-6-10-14-24/h5-14,21,26-27H,2,15-20,32H2,1,3-4H3,(H,33,34)/t21?,26?,27-,31-/m0/s1 |
| InChIKey | BNLLDLSBZNFLMD-NEEBZVDQSA-N |
| XLogP | 7.20 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.66 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |