C29H36N2O — CID 155535510
[(1R,3aR,6aR)-5-hexyl-4-phenyl-3a-(1-phenylethenyl)-2,3,6,6a-tetrahydro-1H-pentalen-1-yl]urea (PubChem CID 155535510) has the molecular formula C29H36N2O and a molecular weight of 428.62 g/mol. Its IUPAC name is [(1R,3aR,6aR)-5-hexyl-4-phenyl-3a-(1-phenylethenyl)-2,3,6,6a-tetrahydro-1H-pentalen-1-yl]urea.
| Compound Name | [(1R,3aR,6aR)-5-hexyl-4-phenyl-3a-(1-phenylethenyl)-2,3,6,6a-tetrahydro-1H-pentalen-1-yl]urea |
|---|---|
| PubChem CID | 155535510 |
| Molecular Formula | C29H36N2O |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | [(1R,3aR,6aR)-5-hexyl-4-phenyl-3a-(1-phenylethenyl)-2,3,6,6a-tetrahydro-1H-pentalen-1-yl]urea |
| SMILES | C=C(c1ccccc1)[C@@]12CC[C@@H](NC(N)=O)[C@@H]1CC(CCCCCC)=C2c1ccccc1 |
| InChI | InChI=1S/C29H36N2O/c1-3-4-5-8-17-24-20-25-26(31-28(30)32)18-19-29(25,21(2)22-13-9-6-10-14-22)27(24)23-15-11-7-12-16-23/h6-7,9-16,25-26H,2-5,8,17-20H2,1H3,(H3,30,31,32)/t25-,26+,29-/m0/s1 |
| InChIKey | XPASWESTQXPXCV-HFASVGIHSA-N |
| XLogP | 6.96 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|