C28H35NO — CID 155299048
4-(3-aminophenyl)-5-hexyl-3a-(1-phenylethenyl)-2,3,6,6a-tetrahydro-1H-pentalen-1-ol (PubChem CID 155299048) has the molecular formula C28H35NO and a molecular weight of 401.59 g/mol. Its IUPAC name is 4-(3-aminophenyl)-5-hexyl-3a-(1-phenylethenyl)-2,3,6,6a-tetrahydro-1H-pentalen-1-ol.
| Compound Name | 4-(3-aminophenyl)-5-hexyl-3a-(1-phenylethenyl)-2,3,6,6a-tetrahydro-1H-pentalen-1-ol |
|---|---|
| PubChem CID | 155299048 |
| Molecular Formula | C28H35NO |
| Molecular Weight | 401.59 g/mol |
| Exact Mass | 401.27 |
| IUPAC Name | 4-(3-aminophenyl)-5-hexyl-3a-(1-phenylethenyl)-2,3,6,6a-tetrahydro-1H-pentalen-1-ol |
| SMILES | C=C(c1ccccc1)C12CCC(O)C1CC(CCCCCC)=C2c1cccc(N)c1 |
| InChI | InChI=1S/C28H35NO/c1-3-4-5-7-13-23-19-25-26(30)16-17-28(25,20(2)21-11-8-6-9-12-21)27(23)22-14-10-15-24(29)18-22/h6,8-12,14-15,18,25-26,30H,2-5,7,13,16-17,19,29H2,1H3 |
| InChIKey | JRHUBWCWSLWNLG-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.59 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|