C28H35N — CID 155526845
(1S,3aR,6aR)-5-hexyl-4-phenyl-3a-(1-phenylethenyl)-2,3,6,6a-tetrahydro-1H-pentalen-1-amine (PubChem CID 155526845) has the molecular formula C28H35N and a molecular weight of 385.60 g/mol. Its IUPAC name is (1S,3aR,6aR)-5-hexyl-4-phenyl-3a-(1-phenylethenyl)-2,3,6,6a-tetrahydro-1H-pentalen-1-amine.
| Compound Name | (1S,3aR,6aR)-5-hexyl-4-phenyl-3a-(1-phenylethenyl)-2,3,6,6a-tetrahydro-1H-pentalen-1-amine |
|---|---|
| PubChem CID | 155526845 |
| Molecular Formula | C28H35N |
| Molecular Weight | 385.60 g/mol |
| Exact Mass | 385.28 |
| IUPAC Name | (1S,3aR,6aR)-5-hexyl-4-phenyl-3a-(1-phenylethenyl)-2,3,6,6a-tetrahydro-1H-pentalen-1-amine |
| SMILES | C=C(c1ccccc1)[C@@]12CC[C@H](N)[C@@H]1CC(CCCCCC)=C2c1ccccc1 |
| InChI | InChI=1S/C28H35N/c1-3-4-5-8-17-24-20-25-26(29)18-19-28(25,21(2)22-13-9-6-10-14-22)27(24)23-15-11-7-12-16-23/h6-7,9-16,25-26H,2-5,8,17-20,29H2,1H3/t25-,26-,28-/m0/s1 |
| InChIKey | KBZKIMOXGGMQPU-NSVAZKTRSA-N |
| XLogP | 7.25 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.60 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|