C34H39N — CID 52937447
(3aS,6aR)-2-benzyl-5-hexyl-4-phenyl-3a-(1-phenylethenyl)-1,3,6,6a-tetrahydrocyclopenta[c]pyrrole (PubChem CID 52937447) has the molecular formula C34H39N and a molecular weight of 461.69 g/mol. Its IUPAC name is (3aS,6aR)-2-benzyl-5-hexyl-4-phenyl-3a-(1-phenylethenyl)-1,3,6,6a-tetrahydrocyclopenta[c]pyrrole.
| Compound Name | (3aS,6aR)-2-benzyl-5-hexyl-4-phenyl-3a-(1-phenylethenyl)-1,3,6,6a-tetrahydrocyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 52937447 |
| Molecular Formula | C34H39N |
| Molecular Weight | 461.69 g/mol |
| Exact Mass | 461.31 |
| IUPAC Name | (3aS,6aR)-2-benzyl-5-hexyl-4-phenyl-3a-(1-phenylethenyl)-1,3,6,6a-tetrahydrocyclopenta[c]pyrrole |
| SMILES | C=C(c1ccccc1)[C@@]12CN(Cc3ccccc3)C[C@@H]1CC(CCCCCC)=C2c1ccccc1 |
| InChI | InChI=1S/C34H39N/c1-3-4-5-11-22-31-23-32-25-35(24-28-16-9-6-10-17-28)26-34(32,27(2)29-18-12-7-13-19-29)33(31)30-20-14-8-15-21-30/h6-10,12-21,32H,2-5,11,22-26H2,1H3/t32-,34-/m0/s1 |
| InChIKey | JFILKYCVXYKAKB-TWJUONSBSA-N |
| XLogP | 8.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.69 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|