C28H42 — CID 52937250
(3aR,6aS)-5,6-dihexyl-6a-(1-phenylethenyl)-2,3,3a,4-tetrahydro-1H-pentalene (PubChem CID 52937250) has the molecular formula C28H42 and a molecular weight of 378.64 g/mol. Its IUPAC name is (3aR,6aS)-5,6-dihexyl-6a-(1-phenylethenyl)-2,3,3a,4-tetrahydro-1H-pentalene.
| Compound Name | (3aR,6aS)-5,6-dihexyl-6a-(1-phenylethenyl)-2,3,3a,4-tetrahydro-1H-pentalene |
|---|---|
| PubChem CID | 52937250 |
| Molecular Formula | C28H42 |
| Molecular Weight | 378.64 g/mol |
| Exact Mass | 378.33 |
| IUPAC Name | (3aR,6aS)-5,6-dihexyl-6a-(1-phenylethenyl)-2,3,3a,4-tetrahydro-1H-pentalene |
| SMILES | C=C(c1ccccc1)[C@@]12CCC[C@@H]1CC(CCCCCC)=C2CCCCCC |
| InChI | InChI=1S/C28H42/c1-4-6-8-11-18-25-22-26-19-15-21-28(26,27(25)20-14-9-7-5-2)23(3)24-16-12-10-13-17-24/h10,12-13,16-17,26H,3-9,11,14-15,18-22H2,1-2H3/t26-,28+/m1/s1 |
| InChIKey | SMWCGLYZCKMBEZ-IAPPQJPRSA-N |
| XLogP | 9.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.64 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|