C30H34O — CID 153312876
(3aR)-1-ethynyl-5-hexyl-4-phenyl-3a-(1-phenylethenyl)-2,3,6,6a-tetrahydropentalen-1-ol (PubChem CID 153312876) has the molecular formula C30H34O and a molecular weight of 410.60 g/mol. Its IUPAC name is (3aR)-1-ethynyl-5-hexyl-4-phenyl-3a-(1-phenylethenyl)-2,3,6,6a-tetrahydropentalen-1-ol.
| Compound Name | (3aR)-1-ethynyl-5-hexyl-4-phenyl-3a-(1-phenylethenyl)-2,3,6,6a-tetrahydropentalen-1-ol |
|---|---|
| PubChem CID | 153312876 |
| Molecular Formula | C30H34O |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | (3aR)-1-ethynyl-5-hexyl-4-phenyl-3a-(1-phenylethenyl)-2,3,6,6a-tetrahydropentalen-1-ol |
| SMILES | C#CC1(O)CC[C@@]2(C(=C)c3ccccc3)C(c3ccccc3)=C(CCCCCC)CC12 |
| InChI | InChI=1S/C30H34O/c1-4-6-7-10-19-26-22-27-29(31,5-2)20-21-30(27,23(3)24-15-11-8-12-16-24)28(26)25-17-13-9-14-18-25/h2,8-9,11-18,27,31H,3-4,6-7,10,19-22H2,1H3/t27?,29?,30-/m0/s1 |
| InChIKey | PKDPTYHFZPXEKL-ISLPKECHSA-N |
| XLogP | 7.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|