C28H35NO3S — CID 175901335
[5-hexyl-4-phenyl-3a-(1-phenylethenyl)-2,3,6,6a-tetrahydro-1H-pentalen-1-yl] sulfamate (PubChem CID 175901335) has the molecular formula C28H35NO3S and a molecular weight of 465.66 g/mol. Its IUPAC name is [5-hexyl-4-phenyl-3a-(1-phenylethenyl)-2,3,6,6a-tetrahydro-1H-pentalen-1-yl] sulfamate.
| Compound Name | [5-hexyl-4-phenyl-3a-(1-phenylethenyl)-2,3,6,6a-tetrahydro-1H-pentalen-1-yl] sulfamate |
|---|---|
| PubChem CID | 175901335 |
| Molecular Formula | C28H35NO3S |
| Molecular Weight | 465.66 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | [5-hexyl-4-phenyl-3a-(1-phenylethenyl)-2,3,6,6a-tetrahydro-1H-pentalen-1-yl] sulfamate |
| SMILES | C=C(c1ccccc1)C12CCC(OS(N)(=O)=O)C1CC(CCCCCC)=C2c1ccccc1 |
| InChI | InChI=1S/C28H35NO3S/c1-3-4-5-8-17-24-20-25-26(32-33(29,30)31)18-19-28(25,21(2)22-13-9-6-10-14-22)27(24)23-15-11-7-12-16-23/h6-7,9-16,25-26H,2-5,8,17-20H2,1H3,(H2,29,30,31) |
| InChIKey | TUITYPXKFZGOFR-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.66 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|