C28H33N7O2S — CID 155322711
1-[4-methoxy-5-[[4-[2-(methylamino)phenyl]thieno[2,3-d]pyrimidin-2-yl]amino]-2-(4-methylpiperazin-1-yl)anilino]prop-2-en-1-ol (PubChem CID 155322711) has the molecular formula C28H33N7O2S and a molecular weight of 531.69 g/mol. Its IUPAC name is 1-[4-methoxy-5-[[4-[2-(methylamino)phenyl]thieno[2,3-d]pyrimidin-2-yl]amino]-2-(4-methylpiperazin-1-yl)anilino]prop-2-en-1-ol.
| Compound Name | 1-[4-methoxy-5-[[4-[2-(methylamino)phenyl]thieno[2,3-d]pyrimidin-2-yl]amino]-2-(4-methylpiperazin-1-yl)anilino]prop-2-en-1-ol |
|---|---|
| PubChem CID | 155322711 |
| Molecular Formula | C28H33N7O2S |
| Molecular Weight | 531.69 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | 1-[4-methoxy-5-[[4-[2-(methylamino)phenyl]thieno[2,3-d]pyrimidin-2-yl]amino]-2-(4-methylpiperazin-1-yl)anilino]prop-2-en-1-ol |
| SMILES | C=CC(O)Nc1cc(Nc2nc(-c3ccccc3NC)c3ccsc3n2)c(OC)cc1N1CCN(C)CC1 |
| InChI | InChI=1S/C28H33N7O2S/c1-5-25(36)30-21-16-22(24(37-4)17-23(21)35-13-11-34(3)12-14-35)31-28-32-26(19-10-15-38-27(19)33-28)18-8-6-7-9-20(18)29-2/h5-10,15-17,25,29-30,36H,1,11-14H2,2-4H3,(H,31,32,33) |
| InChIKey | MUJKKAFRAFFVFW-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 97.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.69 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|