C18H17FN2O2 — CID 155322814
(4R)-3-[(2E)-2-(3-fluoro-6-iminocyclohexa-2,4-dien-1-ylidene)propyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 155322814) has the molecular formula C18H17FN2O2 and a molecular weight of 312.34 g/mol. Its IUPAC name is (4R)-3-[(2E)-2-(3-fluoro-6-iminocyclohexa-2,4-dien-1-ylidene)propyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(2E)-2-(3-fluoro-6-iminocyclohexa-2,4-dien-1-ylidene)propyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 155322814 |
| Molecular Formula | C18H17FN2O2 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | (4R)-3-[(2E)-2-(3-fluoro-6-iminocyclohexa-2,4-dien-1-ylidene)propyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | [H]/N=C1\C=CC(F)=C\C1=C(\C)CN1C(=O)OC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H17FN2O2/c1-12(15-9-14(19)7-8-16(15)20)10-21-17(11-23-18(21)22)13-5-3-2-4-6-13/h2-9,17,20H,10-11H2,1H3/b15-12+,20-16+/t17-/m0/s1 |
| InChIKey | RKJMXLCDFFEHSW-AWAILBPWSA-N |
| XLogP | 3.94 |
| TPSA | 53.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|