C11H17N — CID 155322845
3-cyclopentyl-2,5-dimethyl-1H-pyrrole (PubChem CID 155322845) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is 3-cyclopentyl-2,5-dimethyl-1H-pyrrole.
| Compound Name | 3-cyclopentyl-2,5-dimethyl-1H-pyrrole |
|---|---|
| PubChem CID | 155322845 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 3-cyclopentyl-2,5-dimethyl-1H-pyrrole |
| SMILES | Cc1cc(C2CCCC2)c(C)[nH]1 |
| InChI | InChI=1S/C11H17N/c1-8-7-11(9(2)12-8)10-5-3-4-6-10/h7,10,12H,3-6H2,1-2H3 |
| InChIKey | PADFZYJLFHCEJO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |