C29H26F2N3O7P — CID 155328376
[(3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4,4-difluoro-3-phenacyloxolan-2-yl]methyl diphenyl phosphate (PubChem CID 155328376) has the molecular formula C29H26F2N3O7P and a molecular weight of 597.51 g/mol. Its IUPAC name is [(3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4,4-difluoro-3-phenacyloxolan-2-yl]methyl diphenyl phosphate.
| Compound Name | [(3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4,4-difluoro-3-phenacyloxolan-2-yl]methyl diphenyl phosphate |
|---|---|
| PubChem CID | 155328376 |
| Molecular Formula | C29H26F2N3O7P |
| Molecular Weight | 597.51 g/mol |
| Exact Mass | 597.15 |
| IUPAC Name | [(3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4,4-difluoro-3-phenacyloxolan-2-yl]methyl diphenyl phosphate |
| SMILES | Nc1ccn([C@@H]2OC(COP(=O)(Oc3ccccc3)Oc3ccccc3)[C@@H](CC(=O)c3ccccc3)C2(F)F)c(=O)n1 |
| InChI | InChI=1S/C29H26F2N3O7P/c30-29(31)23(18-24(35)20-10-4-1-5-11-20)25(39-27(29)34-17-16-26(32)33-28(34)36)19-38-42(37,40-21-12-6-2-7-13-21)41-22-14-8-3-9-15-22/h1-17,23,25,27H,18-19H2,(H2,32,33,36)/t23-,25?,27-/m1/s1 |
| InChIKey | WDAHQZCGQPDVRL-TXQBPDISSA-N |
| XLogP | 5.53 |
| TPSA | 131.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.51 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|