C20H16ClN3O2 — CID 155328395
3-(4-chloroanilino)-4-[(1,5-dimethylindol-3-yl)amino]cyclobut-3-ene-1,2-dione (PubChem CID 155328395) has the molecular formula C20H16ClN3O2 and a molecular weight of 365.82 g/mol. Its IUPAC name is 3-(4-chloroanilino)-4-[(1,5-dimethylindol-3-yl)amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(4-chloroanilino)-4-[(1,5-dimethylindol-3-yl)amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 155328395 |
| Molecular Formula | C20H16ClN3O2 |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 3-(4-chloroanilino)-4-[(1,5-dimethylindol-3-yl)amino]cyclobut-3-ene-1,2-dione |
| SMILES | Cc1ccc2c(c1)c(Nc1c(Nc3ccc(Cl)cc3)c(=O)c1=O)cn2C |
| InChI | InChI=1S/C20H16ClN3O2/c1-11-3-8-16-14(9-11)15(10-24(16)2)23-18-17(19(25)20(18)26)22-13-6-4-12(21)5-7-13/h3-10,22-23H,1-2H3 |
| InChIKey | CPCCSUNNDGEZQQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|