C17H11BrClNO2 — CID 20917275
3-(2-bromo-4-methylanilino)-4-(4-chlorophenyl)cyclobut-3-ene-1,2-dione (PubChem CID 20917275) has the molecular formula C17H11BrClNO2 and a molecular weight of 376.64 g/mol. Its IUPAC name is 3-(2-bromo-4-methylanilino)-4-(4-chlorophenyl)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(2-bromo-4-methylanilino)-4-(4-chlorophenyl)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 20917275 |
| Molecular Formula | C17H11BrClNO2 |
| Molecular Weight | 376.64 g/mol |
| Exact Mass | 374.97 |
| IUPAC Name | 3-(2-bromo-4-methylanilino)-4-(4-chlorophenyl)cyclobut-3-ene-1,2-dione |
| SMILES | Cc1ccc(Nc2c(-c3ccc(Cl)cc3)c(=O)c2=O)c(Br)c1 |
| InChI | InChI=1S/C17H11BrClNO2/c1-9-2-7-13(12(18)8-9)20-15-14(16(21)17(15)22)10-3-5-11(19)6-4-10/h2-8,20H,1H3 |
| InChIKey | ZAJKRISIMBWUMS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.64 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|