C18H14ClNO3 — CID 22550292
3-(5-chloro-2-methoxyanilino)-4-(4-methylphenyl)cyclobut-3-ene-1,2-dione (PubChem CID 22550292) has the molecular formula C18H14ClNO3 and a molecular weight of 327.77 g/mol. Its IUPAC name is 3-(5-chloro-2-methoxyanilino)-4-(4-methylphenyl)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(5-chloro-2-methoxyanilino)-4-(4-methylphenyl)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 22550292 |
| Molecular Formula | C18H14ClNO3 |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 3-(5-chloro-2-methoxyanilino)-4-(4-methylphenyl)cyclobut-3-ene-1,2-dione |
| SMILES | COc1ccc(Cl)cc1Nc1c(-c2ccc(C)cc2)c(=O)c1=O |
| InChI | InChI=1S/C18H14ClNO3/c1-10-3-5-11(6-4-10)15-16(18(22)17(15)21)20-13-9-12(19)7-8-14(13)23-2/h3-9,20H,1-2H3 |
| InChIKey | ZGGLDEFXWRJRNJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|